CymitQuimica logo

CAS 43229-67-0

:

α-[[[2-(4-Methoxyphenyl)-1-methylethyl](phenylmethyl)amino]methyl]-3-nitro-4-(phenylmethoxy)benzenemethanol

Description:
The chemical substance known as α-[[[2-(4-Methoxyphenyl)-1-methylethyl](phenylmethyl)amino]methyl]-3-nitro-4-(phenylmethoxy)benzenemethanol, with the CAS number 43229-67-0, is a complex organic compound characterized by its intricate molecular structure. It features multiple functional groups, including an amine, nitro, and methoxy groups, which contribute to its chemical reactivity and potential biological activity. The presence of aromatic rings suggests that it may exhibit significant π-π interactions, influencing its solubility and stability in various solvents. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, although specific biological activities would require empirical investigation. Its synthesis and characterization would typically involve advanced organic chemistry techniques, including spectroscopic methods for structural elucidation. As with many organic compounds, safety data and handling precautions are essential, particularly due to the presence of the nitro group, which can impart explosive properties under certain conditions.
Formula:C32H34N2O5
InChI:InChI=1S/C32H34N2O5/c1-24(19-25-13-16-29(38-2)17-14-25)33(21-26-9-5-3-6-10-26)22-31(35)28-15-18-32(30(20-28)34(36)37)39-23-27-11-7-4-8-12-27/h3-18,20,24,31,35H,19,21-23H2,1-2H3
InChI key:InChIKey=STIBLONETZHESW-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(N(=O)=O)C=C(C(CN(CC3=CC=CC=C3)C(CC4=CC=C(OC)C=C4)C)O)C=C2
Synonyms:
  • Benzenemethanol, α-[[[2-(4-methoxyphenyl)-1-methylethyl](phenylmethyl)amino]methyl]-3-nitro-4-(phenylmethoxy)-
  • α-[[[2-(4-Methoxyphenyl)-1-methylethyl](phenylmethyl)amino]methyl]-3-nitro-4-(phenylmethoxy)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.