CAS 4324-55-4: 6-Hydroxykaempferol

Description:6-Hydroxykaempferol, with the CAS number 4324-55-4, is a flavonoid compound belonging to the flavonol class. It is characterized by its hydroxyl group at the 6-position of the kaempferol structure, which contributes to its biological activity and potential health benefits. This compound is typically found in various plants and is known for its antioxidant properties, which can help neutralize free radicals and reduce oxidative stress. Additionally, 6-hydroxykaempferol exhibits anti-inflammatory and anti-cancer activities, making it of interest in pharmacological research. Its solubility is generally moderate in organic solvents, and it may exhibit varying degrees of solubility in water depending on the pH. The compound's molecular structure includes multiple aromatic rings, which are characteristic of flavonoids, contributing to its stability and reactivity. Overall, 6-hydroxykaempferol is a significant compound in the study of natural products and their potential therapeutic applications.

Formula:C₁₅H₁₀O₇

InChI:InChI=1S/C15H10O7/c16-7-3-1-6(2-4-7)15-14(21)13(20)10-9(22-15)5-8(17)11(18)12(10)19/h1-5,16-19,21H

InChI key:InChIKey=LFPHMXIOQBBTSS-UHFFFAOYSA-N

SMILES:O=C1C(O)=C(OC2=CC(O)=C(O)C(O)=C12)C=3C=CC(O)=CC3

Synonyms:
Norvogeletin
4H-1-Benzopyran-4-one, 3,5,6,7-tetrahydroxy-2-(4-hydroxyphenyl)-
Galetin
3,5,6,7-Tetrahydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
Flavone, 3,4′,5,6,7-pentahydroxy-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	6-Hydroxykaempferol REF: TM-TN1314CAS: 4324-55-4	98%	To inquire	Mon 21 Apr 25
	6-Hydroxykaempferol REF: 3D-EAA32455CAS: 4324-55-4	Min. 95%	To inquire	Thu 29 May 25