CAS 432496-28-1

N-(4-bromo-2-methylphenyl)-2-[4-(propan-2-yl)phenoxy]acetamide

Description:

N-(4-bromo-2-methylphenyl)-2-[4-(propan-2-yl)phenoxy]acetamide, with the CAS number 432496-28-1, is a synthetic organic compound characterized by its complex structure, which includes a brominated aromatic ring and an acetamide functional group. This compound features a 4-bromo-2-methylphenyl moiety, contributing to its potential biological activity, and a 4-(propan-2-yl)phenoxy group that enhances its lipophilicity. The presence of these functional groups suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biochemical pathways. The compound's molecular structure indicates it may be soluble in organic solvents, while its interactions with biological systems could be influenced by the steric and electronic effects of the bromine and isopropyl groups. As with many synthetic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reactants or biological targets. Further studies would be necessary to fully elucidate its properties and potential uses in medicinal chemistry or other fields.

Formula: C₁₈H₂₀BrNO₂

InChI: InChI=1/C18H20BrNO2/c1-12(2)14-4-7-16(8-5-14)22-11-18(21)20-17-9-6-15(19)10-13(17)3/h4-10,12H,11H2,1-3H3,(H,20,21)

SMILES: CC(C)c1ccc(cc1)OCC(=O)Nc1ccc(cc1C)Br

Synonyms:

• acetamide, N-(4-bromo-2-methylphenyl)-2-[4-(1-methylethyl)phenoxy]-
• N-(4-Bromo-2-methylphenyl)-2-(4-isopropylphenoxy)acetamide

N-(4-bromo-2-methylphenyl)-2-(4-isopropylphenoxy)acetamide

CAS: 432496-28-1

Formula: C₁₈H₂₀BrNO₂

Purity: 95.0%

Molecular weight: 362.267

Ref: 10-F315188