CAS 432531-90-3: 1-[bis(1-methylethyl)amino]-3-(2-bromophenoxy)propan-2-ol

Description:1-[Bis(1-methylethyl)amino]-3-(2-bromophenoxy)propan-2-ol, with the CAS number 432531-90-3, is a chemical compound characterized by its complex structure, which includes a propanol backbone substituted with a bromophenoxy group and a bis(1-methylethyl)amino moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl group. The presence of the bromine atom in the aromatic ring may impart specific reactivity and influence the compound's overall polarity and lipophilicity. Additionally, the bulky isopropyl groups attached to the nitrogen can affect steric hindrance and the compound's biological activity. Such compounds may be of interest in medicinal chemistry and pharmacology, potentially serving as intermediates or active pharmaceutical ingredients. However, specific applications and safety profiles would require further investigation and analysis in the context of their intended use.

Formula:C₁₅H₂₄BrNO₂

InChI:InChI=1/C15H24BrNO2/c1-11(2)17(12(3)4)9-13(18)10-19-15-8-6-5-7-14(15)16/h5-8,11-13,18H,9-10H2,1-4H3