CAS 432538-73-3

7-hydroxy-4-phenyl-3,4-dihydronaphthalen-1(2H)-one

Description:

7-Hydroxy-4-phenyl-3,4-dihydronaphthalen-1(2H)-one, with the CAS number 432538-73-3, is an organic compound characterized by its naphthalene-derived structure featuring a hydroxyl group and a phenyl substituent. This compound typically exhibits properties associated with polycyclic aromatic compounds, including potential hydrophobicity and the ability to engage in π-π stacking interactions due to its aromatic rings. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features may contribute to its potential as a ligand in various biochemical interactions. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature. Overall, 7-hydroxy-4-phenyl-3,4-dihydronaphthalen-1(2H)-one represents a complex molecule with diverse potential applications in research and industry.

Formula: C₁₆H₁₄O₂

InChI: InChI=1/C16H14O2/c17-12-6-7-14-13(11-4-2-1-3-5-11)8-9-16(18)15(14)10-12/h1-7,10,13,17H,8-9H2

SMILES: c1ccc(cc1)C1CCC(=O)c2cc(ccc12)O

7-hydroxy-4-phenyl-3,4-dihydronaphthalen-1(2H)-one

CAS: 432538-73-3

Purity: 95.0%

Molecular weight: 238.28599548339844

Ref: 10-F315211