CAS 4330-22-7

5-fluoro-2,4-dimethoxypyrimidine

Description:

5-Fluoro-2,4-dimethoxypyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a fluorine atom and two methoxy groups. The presence of the fluorine atom at the 5-position enhances its biological activity and lipophilicity, making it of interest in pharmaceutical research. The methoxy groups at the 2 and 4 positions contribute to the compound's overall polarity and can influence its reactivity and solubility in various solvents. This compound typically appears as a white to off-white solid and is soluble in organic solvents like methanol and ethanol. Its molecular structure allows for potential interactions with biological targets, making it relevant in the development of agrochemicals and medicinal compounds. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its synthesis and application in various chemical reactions. Overall, 5-fluoro-2,4-dimethoxypyrimidine is a significant compound in the field of organic chemistry and drug development.

Formula: C₆H₇FN₂O₂

InChI: InChI=1/C6H7FN2O2/c1-10-5-4(7)3-8-6(9-5)11-2/h3H,1-2H3

InChI key: InChIKey=UVMHPMWNQRWMCB-UHFFFAOYSA-N

SMILES: COc1c(cnc(n1)OC)F

Synonyms:

• 2,4-Dimethoxy-5-fluoropyrimidine
• NSC 109178
• Pyrimidine, 5-fluoro-2,4-dimethoxy-
• T6N Cnj Bo1 Do1 Ef [Wln]
• 5-Fluoro-2,4-dimethoxypyrimidine

5-fluoro-2,4-dimethoxy-pyrimidine

CAS: 4330-22-7

Formula: C₆H₇FN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 158.1304

Ref: IN-DA00745R

5-Fluoro-2,4-dimethoxypyrimidine

CAS: 4330-22-7

5-Fluoro-2,4-dimethoxypyrimidine

Purity: 99%

Molecular weight: 158.13g/mol

Ref: 54-PC100990

5-fluoro-2,4-dimethoxypyrimidine

CAS: 4330-22-7

Formula: C₆H₇FN₂O₂

Purity: 98%

Molecular weight: 158.132

Ref: 10-F370054