CAS 433245-13-7

2-(2,5-dimethyl-1H-pyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid

Description:

2-(2,5-Dimethyl-1H-pyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid is a complex organic compound characterized by its unique structural features, including a pyrrole ring and a benzothiophene moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its heterocyclic structure. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may form salts or esters. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's stability, reactivity, and interactions with biological systems can vary based on environmental conditions such as pH and temperature. Additionally, the presence of multiple methyl groups can influence its lipophilicity and overall biological activity. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Further studies would be necessary to fully elucidate its potential applications and mechanisms of action.

Formula: C₁₅H₁₇NO₂S

InChI: InChI=1/C15H17NO2S/c1-9-7-8-10(2)16(9)14-13(15(17)18)11-5-3-4-6-12(11)19-14/h7-8H,3-6H2,1-2H3,(H,17,18)

SMILES: Cc1ccc(C)n1c1c(c2CCCCc2s1)C(=O)O

Synonyms:

• Benzo[b]thiophene-3-carboxylic acid, 2-(2,5-dimethyl-1H-pyrrol-1-yl)-4,5,6,7-tetrahydro-

2-(2,5-Dimethyl-pyrrol-1-yl)-4,5,6,7-tetrahydro-benzo[ b ]thiophene-3-carboxylic acid

CAS: 433245-13-7

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 275.37

Ref: 10-F027571