CAS 433254-87-6

4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine

Description:

4-(4-Methylphenyl)-5-propyl-1,3-thiazol-2-amine, identified by its CAS number 433254-87-6, is an organic compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a propyl group and a para-methylphenyl group, contributing to its hydrophobic properties. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. The amine functional group in this compound can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the presence of the methyl and propyl substituents can affect the compound's lipophilicity and overall pharmacokinetic properties. Such characteristics make it of interest in various fields, including pharmaceuticals and agrochemicals, where it may exhibit potential therapeutic effects or biological activity. However, specific applications and biological effects would require further investigation and empirical data.

Formula: C₁₃H₁₆N₂S

InChI: InChI=1/C13H16N2S/c1-3-4-11-12(15-13(14)16-11)10-7-5-9(2)6-8-10/h5-8H,3-4H2,1-2H3,(H2,14,15)

SMILES: CCCc1c(c2ccc(C)cc2)[nH]c(=N)s1

Synonyms:

• 2-Thiazolamine, 4-(4-methylphenyl)-5-propyl-

4-(4-Methylphenyl)-5-propyl-1,3-thiazol-2-amine

CAS: 433254-87-6

Formula: C₁₃H₁₆N₂S

Purity: 95.0%

Molecular weight: 232.35

Ref: 10-F042165