CAS 433292-08-1

α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-(trifluoromethyl)benzeneacetic acid

Description:

α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-(trifluoromethyl)benzeneacetic acid, commonly referred to as Fmoc-4-(trifluoromethyl)phenylalanine, is a synthetic amino acid derivative widely used in peptide synthesis and drug development. This compound features a fluorene moiety, which provides stability and protects the amino group during synthesis, while the trifluoromethyl group enhances lipophilicity and biological activity. The presence of the carboxylic acid functional group allows for further coupling reactions, making it versatile in the formation of peptide bonds. Its unique structure contributes to its properties, such as solubility in organic solvents and potential interactions with biological targets. The trifluoromethyl group can also influence the compound's pharmacokinetics and pharmacodynamics, making it a valuable building block in medicinal chemistry. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, showcasing how modifications to amino acids can lead to novel therapeutic agents.

Formula: C₂₄H₁₈F₃NO₄

InChI: InChI=1S/C24H18F3NO4/c25-24(26,27)15-11-9-14(10-12-15)21(22(29)30)28-23(31)32-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20-21H,13H2,(H,28,31)(H,29,30)

InChI key: InChIKey=CGNVYWDHCWJPOR-UHFFFAOYSA-N

SMILES: C(OC(NC(C(O)=O)C1=CC=C(C(F)(F)F)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 2-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)-2-[4-(trifluoromethyl)phenyl]acetic acid
• Benzeneacetic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-(trifluoromethyl)-
• α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-(trifluoromethyl)benzeneacetic acid

2-({[(9H-Fluoren-9-yl)methoxy]carbonyl}amino)-2-[4-(trifluoromethyl)phenyl]acetic acid

CAS: 433292-08-1

Versatile small molecule scaffold

Formula: C₂₄H₁₈F₃NO₄

Purity: Min. 95%

Molecular weight: 441.4 g/mol

Ref: 3D-ISA29208