CymitQuimica logo

CAS 433337-23-6

:

1-decyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide

Description:
1-Decyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide is an ionic liquid characterized by its unique combination of a long-chain alkyl group and a highly polar bis(trifluoromethyl)sulfonyl imide anion. This compound typically exhibits low volatility, high thermal stability, and excellent solvation properties, making it suitable for various applications, including electrochemistry and as a solvent for organic reactions. The imidazolium cation contributes to its ionic nature, while the decyl group enhances its hydrophobic characteristics, allowing for a balance between hydrophilicity and lipophilicity. The presence of the trifluoromethyl groups in the anion imparts strong electron-withdrawing properties, which can influence the compound's reactivity and interaction with other substances. Additionally, this ionic liquid is often noted for its low viscosity and high ionic conductivity, making it an attractive candidate for use in batteries and fuel cells. Overall, its unique properties stem from the interplay between its molecular structure and the functional groups present, leading to a versatile chemical with significant potential in various fields of chemistry and materials science.
Formula:C16H27F6N3O4S2
InChI:InChI=1S/C14H27N2.C2F6NO4S2/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h12-14H,3-11H2,1-2H3;/q+1;-1
InChI key:ZYVGZWFCGPUVSH-UHFFFAOYSA-N
SMILES:CCCCCCCCCCN1C=C[N+](=C1)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Found 6 products.