CAS 4334-87-6
:3-Ethoxycarbonylphenylboronic acid
Description:
3-Ethoxycarbonylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an ethoxycarbonyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The ethoxycarbonyl group contributes to its reactivity and solubility, enhancing its utility in forming complex organic molecules. Additionally, this compound may exhibit acidic properties due to the boronic acid group, which can form reversible complexes with diols, making it useful in sensing applications. Overall, 3-Ethoxycarbonylphenylboronic acid is a versatile compound with significant implications in synthetic organic chemistry and materials science.
Formula:C9H11BO4
InChI:InChI=1/C9H11BO4/c1-2-14-9(11)7-4-3-5-8(6-7)10(12)13/h3-6,12-13H,2H2,1H3
SMILES:CCOC(=O)c1cccc(c1)B(O)O
Synonyms:- 3-(Ethoxycarbonyl)phenylboronic acid
- 3-Borono-benzoic acid 1-ethyl ester
- Akos Brn-0097
- 3-Carbethoxy-Phenyl-Boronic Acid
- 3-(Ethoxycarbonyl)Benzeneboronic Acid
- Ethyl 3-Boronobenzoate
- M-Ethoxycarbonylphenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Ethoxycarbonylphenylboronic acid
CAS:Formula:C9H11BO4Purity:98%Color and Shape:SolidMolecular weight:193.99223-(Ethoxycarbonyl)benzeneboronic acid
CAS:<p>3-(Ethoxycarbonyl)benzeneboronic acid</p>Formula:C9H11BO4Purity:≥95%Color and Shape: white solidMolecular weight:193.99g/mol3-(Ethoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C9H11BO4Color and Shape:White to Almost white powder to crystalMolecular weight:193.993-Ethoxycarbonylphenylboronic acid
CAS:Formula:C9H11BO4Purity:97%Color and Shape:SolidMolecular weight:193.993-(Ethoxycarbonyl)benzeneboronic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.</p>Formula:C9H11BO4Purity:97%Color and Shape:White, PowderMolecular weight:193.99





