CAS 4334-88-7
:4-(Ethoxycarbonyl)phenylboronic acid
Description:
4-(Ethoxycarbonyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an ethoxycarbonyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its structure features a boron atom bonded to a phenyl group and a hydroxyl group, which imparts acidic properties, allowing it to participate in various chemical reactions, including Suzuki coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. The ethoxycarbonyl group enhances its reactivity and solubility, making it useful in medicinal chemistry and materials science. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug delivery systems. Overall, 4-(Ethoxycarbonyl)phenylboronic acid is a versatile compound with significant utility in synthetic organic chemistry and related fields.
Formula:C9H11BO4
InChI:InChI=1S/C9H11BO4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13/h3-6,12-13H,2H2,1H3
InChI key:InChIKey=ZLNFACCFYUFTLD-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=C(B(O)O)C=C1
Synonyms:- (4-(Ethoxycabonyl)phenyl)boronic acid
- 4-(Ethoxycarbonyl)phenylboronic acid
- 4-(Ethoxylcarbonyl)phenylboronic acid
- 4-Carboethoxybenzeneboronic acid
- 4-Ethoxy carbonyl phenylboronic acid:
- 4-Ethoxycarbonylphenylboronic acid
- Benzoic acid, 4-borono-, 1-ethyl ester
- Benzoic acid, p-borono-, 1-ethyl ester
- Benzoic acid, p-borono-, ethyl ester
- Ethyl 4-Boronobenzoat
- Ethyl 4-boronobenzoate
- Ethyl 4-dihydroxyborylbenzoate
- [4-[(Ethyloxy)carbonyl]phenyl]boronic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-(Ethoxycarbonyl)benzeneboronic acid, 94%
CAS:4-(Ethoxycarbonyl)benzeneboronic acid is used as a reactant involved in oxidative hydroxylation for the preparation of phenols, homolytic aromatic substitution, cross-coupling with -bromocarbonyl compounds, Suzuki-coupling reaction with quinoline carboxylates, trifluoromethylation and carbometalatioFormula:C9H11BO4Purity:94%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:193.994-Ethoxycarbonylphenylboronic acid
CAS:Formula:C9H11BO4Purity:98%Color and Shape:SolidMolecular weight:193.99224-(Ethoxycarbonyl)benzeneboronic acid
CAS:4-(Ethoxycarbonyl)benzeneboronic acidFormula:C9H11BO4Purity:≥95%Color and Shape: white crystalline solidMolecular weight:193.99g/mol4-(Ethoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C9H11BO4Color and Shape:White to Almost white powder to crystalMolecular weight:193.994-Ethoxycarbonylphenylboronic acid
CAS:Formula:C9H11BO4Purity:97%Color and Shape:SolidMolecular weight:193.994-(Ethoxycarbonyl)phenylboronic acid
CAS:4-(Ethoxycarbonyl)phenylboronic acid is a potential use for picric acid detection. It has been shown to be a chemosensor with an electrochemical impedance spectroscopy response that is sensitive to chloride ions. 4-(Ethoxycarbonyl)phenylboronic acid can be used as a linker in multigram-scale synthesis of aryl halides, and its reaction mechanism has been elucidated by crystal x-ray diffraction. The synthesis of this compound is scalable and involves the formation of an apical carboxylate from ethoxycarbonyl phenyl boronic acid and an aryl halide.Formula:C9H11BO4Purity:Min. 95%Color and Shape:PowderMolecular weight:193.99 g/mol






