CymitQuimica logo

CAS 433711-95-6

:

4-(Boc-amino)-2-bromopyridine

Description:
4-(Boc-amino)-2-bromopyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a bromine atom at the 2-position and a tert-butyloxycarbonyl (Boc) protecting group attached to an amino group at the 4-position. This structure makes it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The Boc group serves to protect the amine during various chemical reactions, allowing for selective modifications of other functional groups. The presence of the bromine atom enhances the compound's reactivity, making it suitable for nucleophilic substitution reactions. Additionally, 4-(Boc-amino)-2-bromopyridine is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Overall, this compound is significant in synthetic organic chemistry due to its functional versatility and reactivity.
Formula:C10H13BrN2O2
InChI:InChI=1/C10H13BrN2O2/c1-10(2,3)15-9(14)13-7-4-5-12-8(11)6-7/h4-6H,1-3H3,(H,12,13,14)
InChI key:DCYAZECOQNZWBD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1ccnc(c1)Br)O
Synonyms:
  • tert-Butyl2-bromopyridin-4-ylcarbamate
  • 2-Bromo-4-(tert-butoxycarbonylamino)pyridine
  • Tert-Butyl (2-Bromopyridin-4-Yl)Carbamate
  • N-Boc-4-Amino-2-bromopyridine
Found 4 products.