CAS 4338-06-1
:Nitrophenylmaleimide; 96%
Description:
Nitrophenylmaleimide, with the CAS number 4338-06-1, is an organic compound characterized by its maleimide structure substituted with a nitrophenyl group. This compound typically appears as a yellow to orange crystalline solid and is known for its reactivity, particularly in Michael addition reactions and as a potential electrophile in various organic syntheses. It is often utilized in the field of polymer chemistry, especially in the development of functionalized polymers and as a crosslinking agent. The presence of the nitro group enhances its electrophilic properties, making it useful in various chemical transformations. Nitrophenylmaleimide is generally handled with care due to its potential toxicity and the need for appropriate safety measures during use. Its applications extend to materials science and medicinal chemistry, where it may serve as a precursor for more complex molecules. As with many chemical substances, proper storage and handling protocols are essential to ensure safety and stability.
Formula:C10H6N2O4
InChI:InChI=1/C10H6N2O4/c13-9-5-6-10(14)11(9)7-1-3-8(4-2-7)12(15)16/h1-6H
SMILES:c1cc(ccc1N1C(=O)C=CC1=O)N(=O)=O
Synonyms:- N-(4-Nitrophenyl)maleimide
- 1-(4-Nitrophenyl)-1H-pyrrole-2,5-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-(4-Nitrophenyl)maleimide
CAS:Formula:C10H6N2O4Purity:>98.0%(HPLC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:218.17N-(4-NITROPHENYL)MALEIMIDE
CAS:Formula:C10H6N2O4Purity:98%Color and Shape:SolidMolecular weight:218.1656N-(4-Nitrophenyl)maleimide
CAS:N-(4-Nitrophenyl)maleimide is a nitro compound that has been shown to be an inhibitor of the enzyme phthalimidase, which catalyzes the hydrolysis of phthalimides. It inhibits the growth of marine sponges and other microorganisms by reacting with primary amino groups in proteins. N-(4-Nitrophenyl)maleimide has also been shown to inhibit the biosynthesis of DNA and RNA.Formula:C10H6N2O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:218.17 g/mol1-(4-Nitro-phenyl)pyrrole-2,5-dione
CAS:Formula:C10H6N2O4Purity:98%(GC-MS);RGMolecular weight:218.168




