CymitQuimica logo

CAS 433969-27-8

:

Carbamic acid,N-[(2-boronophenyl)methyl]-, C-(1,1-dimethylethyl) ester

Description:
Carbamic acid, N-[(2-boronophenyl)methyl]-, C-(1,1-dimethylethyl) ester, identified by the CAS number 433969-27-8, is an organic compound characterized by the presence of a carbamate functional group. This compound features a boron-containing aromatic moiety, which can enhance its reactivity and potential applications in medicinal chemistry and materials science. The presence of the tert-butyl ester group contributes to its stability and solubility properties, making it suitable for various chemical reactions. The boron atom in the structure may facilitate interactions with biological targets or act as a catalyst in certain reactions. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in drug development or as a reagent in organic synthesis. Overall, the characteristics of this compound suggest potential utility in both synthetic and pharmaceutical chemistry, although specific applications would depend on further research and exploration of its properties.
Formula:C12H18BNO4
InChI:InChI=1S/C12H18BNO4/c1-12(2,3)18-11(15)14-8-9-6-4-5-7-10(9)13(16)17/h4-7,16-17H,8H2,1-3H3,(H,14,15)
InChI key:NVCGSIBAXVRMLU-UHFFFAOYSA-N
SMILES:B(C1=CC=CC=C1CNC(=O)OC(C)(C)C)(O)O
Synonyms:
  • Carbamicacid, [(2-boronophenyl)methyl]-, C-(1,1-dimethylethyl) ester
  • 2-Boc-Aminomethyl-phenylboronic acid
Found 3 products.