CAS 434-76-4
:2-Amino-6-fluorobenzoic acid
Description:
2-Amino-6-fluorobenzoic acid, with the CAS number 434-76-4, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid and amino functional groups. The fluorine substitution at the 6-position of the benzene ring can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering interaction with biological targets. 2-Amino-6-fluorobenzoic acid is utilized in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. As with many chemical substances, proper handling and safety measures should be observed, as it may pose health risks if ingested or inhaled.
Formula:C7H6FNO2
InChI:InChI=1/C7H6FNO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,9H2,(H,10,11)
SMILES:c1cc(c(c(c1)N)F)C(=O)O
Synonyms:- 2-Amino-6-Fluorobenzoate
- 6-Fluoroanthranilic acid
- 2-Amino-6-flouro benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Amino-6-fluorobenzoic Acid
CAS:Formula:C7H6FNO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:155.132-Amino-6-fluorobenzoic acid, 98%
CAS:Used in the synthesis of a novel benzamide with potent neuroleptic activity. 5- fluoro-2-methyl-3,l-benzoxazin-4-one was obtained from 2-amino-6-fluorobenzoic acid. The condensation of 2-amino-6-fluorobenzoic acid methyl ester and (4-fluorophenyl) acetyl chloride with N,N-dimethylamino-4-pyridine inFormula:C7H6FNO2Purity:98%Color and Shape:Crystals or powder or crystalline powder, White to cream to yellow to pale brownMolecular weight:155.132-Amino-6-fluorobenzoic acid
CAS:Formula:C7H6FNO2Purity:98%Color and Shape:SolidMolecular weight:155.1264Ref: IN-DA003GIF
10kgTo inquire25kgTo inquire10g20.00€5g21.00€25g29.00€100g56.00€500g134.00€5kg550.00€2-Amino-6-fluorobenzoic acid
CAS:Formula:C7H6FNO2Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:155.132-Amino-6-fluorobenzoic acid
CAS:2-Amino-6-fluorobenzoic acidFormula:C7H6FNO2Purity:97%Color and Shape: faint yellow crystalline solidMolecular weight:155.13g/mol2-Amino-6-fluorobenzoic acid
CAS:Formula:C7H6FNO2Purity:97%Color and Shape:SolidMolecular weight:155.1282-Amino-6-fluorobenzoic acid
CAS:Intermediate in the synthesis of idelalisib
Formula:C7H6FNO2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:155.13 g/molRef: 3D-FA11268
Discontinued product






