CAS 4342-07-8
:5-amino-2H-1,2,3-triazole-4-carboxamide
Description:
5-Amino-2H-1,2,3-triazole-4-carboxamide, with the CAS number 4342-07-8, is a heterocyclic organic compound characterized by its triazole ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) that contribute to its reactivity and solubility in polar solvents. It is typically a white to off-white crystalline solid, and its molecular structure allows for hydrogen bonding, which can enhance its solubility in water. The presence of the amino and carboxamide functional groups makes it a potential candidate for various applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, compounds of this nature may exhibit biological activity, including antimicrobial and antifungal properties, making them of interest in medicinal chemistry. Proper handling and storage are essential due to potential reactivity and safety considerations associated with nitrogen-containing heterocycles.
Formula:C3H5N5O
InChI:InChI=1/C3H5N5O/c4-2-1(3(5)9)6-8-7-2/h(H2,5,9)(H3,4,6,7,8)
SMILES:c1(c(N)[nH]nn1)C(=N)O
Synonyms:- 1H-1,2,3-triazole-4-carboxamide, 5-amino-
- 1H-1,2,3-triazole-5-carboxamide, 4-amino-
- 5-Amino-1H-1,2,3-triazole-4-carboxamide
- 5-amino-2H-1,2,3-triazol-4-ylformamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
