CAS 4342-60-3
:4-methylcyclohex-3-ene-1-carboxylic acid
Description:
4-Methylcyclohex-3-ene-1-carboxylic acid is an organic compound characterized by its cyclohexene structure, which includes a carboxylic acid functional group and a methyl substituent. This compound features a double bond in the cyclohexene ring, contributing to its reactivity and potential for undergoing various chemical reactions, such as electrophilic addition or polymerization. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in acid-base reactions and potentially form salts or esters. Its molecular structure suggests it may exhibit stereoisomerism due to the presence of the double bond and the substituents on the ring. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and conditions. It may have applications in organic synthesis, particularly in the production of more complex molecules or as an intermediate in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H12O2
InChI:InChI=1/C8H12O2/c1-6-2-4-7(5-3-6)8(9)10/h2,7H,3-5H2,1H3,(H,9,10)
SMILES:CC1=CCC(CC1)C(=O)O
Synonyms:- 3-Cyclohexene-1-carboxylic acid, 4-methyl-
- 4-Methylcyclohex-3-enecarboxylic acid
- 4-Methyl-3-cyclohexene-1-carboxylicAcid>
- 4-Methyl-3-cyclohexene-1-carboxylic Acid
- 4-Methylcyclohex-3-ene-1-carboxylicacid
- 4-Methylcyclohex-3-Ene-1-Carboxylic Acid(WX610371)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methyl-3-cyclohexene-1-carboxylic Acid
CAS:Formula:C8H12O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:140.184-Methyl-3-cyclohexene-1-carboxylic Acid
CAS:Formula:C8H12O2Purity:98%Color and Shape:SolidMolecular weight:140.17974-Methylcyclohex-3-ene-1-carboxylic acid
CAS:<p>4-Methylcyclohex-3-ene-1-carboxylic acid</p>Molecular weight:140.18g/mol4-Methyl-3-cyclohexene-1-carboxylic Acid
CAS:Formula:C8H12O2Purity:98%Color and Shape:SolidMolecular weight:140.1824-Methylcyclohex-3-ene-1-carboxylic acid
CAS:<p>4-Methylcyclohex-3-ene-1-carboxylic acid is an anionic compound that is used in the preparation of perfumes. This substance has been shown to have a cycloaddition reaction with nonionic detergents and isoprene, catalyzing the oxidation of terephthalic acid to ethylene. 4-Methylcyclohex-3-ene-1-carboxylic acid can also be used as a medicinal agent for aromatization or as a catalyst for the production of aldehydes.</p>Formula:C8H12O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:140.18 g/mol




