CymitQuimica logo

CAS 4343-75-3

:

4-amino-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:
4-Amino-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 4343-75-3, is a heterocyclic compound characterized by its triazole ring structure, which contains both nitrogen and sulfur atoms. This compound features an amino group (-NH2) and a thione group (C=S), contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit moderate stability under standard conditions. The presence of the amino group allows for hydrogen bonding, which can influence its solubility and interaction with other molecules. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules or as a bioactive agent. Its unique structural features may also impart specific properties, such as antimicrobial or antifungal activity, making it a subject of research in medicinal chemistry. Proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C2H4N4S
InChI:InChI=1/C2H4N4S/c3-6-1-4-5-2(6)7/h1H,3H2,(H,5,7)
InChI key:DLLBXBCKFUPBJE-UHFFFAOYSA-N
SMILES:c1nnc(n1N)S
Synonyms:
  • 4-Amino-4H-1,2,4-triazole-3-thiol
  • 4H-1,2,4-Triazole-3-thiol, 4-amino-
Found 4 products.