CAS 434303-68-1

2-(4-bromo-2-methylphenoxy)-N-(3-chloro-4-methylphenyl)acetamide

Description:

2-(4-bromo-2-methylphenoxy)-N-(3-chloro-4-methylphenyl)acetamide is a synthetic organic compound characterized by its complex structure, which includes a phenoxy group and an acetamide moiety. The presence of bromine and chlorine substituents on the aromatic rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic groups, which may affect its solubility in organic solvents and its interaction with biological membranes. The acetamide functional group suggests potential for hydrogen bonding, which could play a role in its pharmacological properties. Additionally, the specific arrangement of substituents may impart selectivity in biological systems, making it of interest in medicinal chemistry. As with many halogenated compounds, it is important to consider environmental and safety aspects, including potential toxicity and persistence in biological systems. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and biological applications.

Formula: C₁₆H₁₅BrClNO₂

InChI: InChI=1/C16H15BrClNO2/c1-10-3-5-13(8-14(10)18)19-16(20)9-21-15-6-4-12(17)7-11(15)2/h3-8H,9H2,1-2H3,(H,19,20)

SMILES: Cc1ccc(cc1Cl)N=C(COc1ccc(cc1C)Br)O

Synonyms:

• acetamide, 2-(4-bromo-2-methylphenoxy)-N-(3-chloro-4-methylphenyl)-

2-(4-bromo-2-methylphenoxy)-N-(3-chloro-4-methylphenyl)acetamide

CAS: 434303-68-1

Formula: C₁₆H₁₅BrClNO₂

Purity: 95.0%

Molecular weight: 368.66

Ref: 10-F315283