CAS 4344-84-7
:5-oxotetrahydrofuran-2-carboxylic acid
Description:
5-Oxotetrahydrofuran-2-carboxylic acid, with the CAS number 4344-84-7, is a heterocyclic organic compound characterized by a tetrahydrofuran ring that contains both a ketone and a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The presence of the oxo group contributes to its reactivity, making it a potential intermediate in organic synthesis. Its structure allows for various chemical transformations, including esterification and amidation, which are useful in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use and the presence of other functional groups in related compounds. Overall, 5-oxotetrahydrofuran-2-carboxylic acid serves as a valuable building block in synthetic organic chemistry.
Formula:C5H6O4
InChI:InChI=1/C5H6O4/c6-4-2-1-3(9-4)5(7)8/h3H,1-2H2,(H,7,8)
SMILES:C1CC(=O)OC1C(=O)O
Synonyms:- 2-Furancarboxylic Acid, Tetrahydro-5-Oxo-
- 5-Oxo-tetrahydro-furan-2-carboxylic acid
- 5-Oxotetrahydrofuran-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tetrahydro-5-oxo-2- furancarboxyli
CAS:Formula:C5H6O4Purity:95%Color and Shape:SolidMolecular weight:130.0987Ref: IN-DA00DBL9
1g25.00€5g28.00€10g46.00€25g72.00€50g104.00€100g149.00€250g264.00€500g705.00€250mg21.00€5-Oxotetrahydrofuran-2-carboxylic acid
CAS:5-Oxotetrahydrofuran-2-carboxylic acidPurity:95%Molecular weight:130.10g/molTridemorph (technical)
CAS:Controlled ProductApplications Carboxybutyrolactone is a structural analog of (±)-Paraconic Acid (P191200) and is used as a reagent in the synthesis of methylenecarboxybutyrolactones which have antibacterial activity.
References Tonari, K., et al.: J. Oleo Sci., 51, 259 (2002)Formula:C5H6O4Color and Shape:Off-WhiteMolecular weight:130.15-Oxotetrahydrofuran-2-carboxylic acid
CAS:Formula:C5H6O4Purity:95%Color and Shape:SolidMolecular weight:130.0995-Oxotetrahydrofuran-2-carboxylic acid
CAS:5-Oxotetrahydrofuran-2-carboxylic acid is a solid phase extraction compound that can be used to extract and purify compounds from biological samples. It is synthesized by an asymmetric synthesis of the acetate ester of 5-hydroxytetrahydrofuran-2-carboxylic acid, which is then hydrolyzed to give the desired product. 5-Oxotetrahydrofuran-2-carboxylic acid has been used in cell culture studies as a diagnostic agent for cancer cells. The reactive nature of this molecule allows it to react with chloride ions and fatty acids, which leads to the death of cancer cells.Formula:C5H6O4Purity:Min. 95%Molecular weight:130.1 g/mol




