CAS 4344-85-8

1H-benzimidazol-2-ylmethanethiol

Description:

1H-benzimidazol-2-ylmethanethiol, with the CAS number 4344-85-8, is a chemical compound characterized by its unique structure that features a benzimidazole ring, which is a bicyclic compound consisting of a fused benzene and imidazole ring. This compound contains a thiol (-SH) group, which imparts significant reactivity and potential for forming disulfide bonds, making it useful in various chemical applications. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the thiol group. The compound is of interest in medicinal chemistry and biochemistry, as thiols can play crucial roles in biological systems, including enzyme function and redox reactions. Additionally, the benzimidazole moiety is known for its pharmacological properties, including antimicrobial and antifungal activities. Safety data should be consulted for handling, as thiols can be malodorous and may pose health risks if not managed properly. Overall, 1H-benzimidazol-2-ylmethanethiol is a versatile compound with applications in research and industry.

Formula: C₈H₈N₂S

InChI: InChI=1/C8H8N2S/c11-5-8-9-6-3-1-2-4-7(6)10-8/h1-4,11H,5H2,(H,9,10)

SMILES: c1ccc2c(c1)nc(CS)[nH]2

Synonyms:

• 1H-benzimidazole-2-methanethiol
• 2-Mercaptomethylbenzimidazole

(1h-Benzo[d]imidazol-2-yl)methanethiol

CAS: 4344-85-8

(1h-Benzo[d]imidazol-2-yl)methanethiol

Purity: 95+%

Ref: 54-OR1038849

(1h-Benzo[d]imidazol-2-yl)methanethiol

CAS: 4344-85-8

Purity: 95+%

Molecular weight: 164.2299957

Ref: 10-F679809