CAS 4348-76-9
:Dirhamnolipid(2-o-α-l-rhamnopyranosyl-α-l-rhamnopyranosyl-β-hydroxydecanoyl-β-hydroxydecanoate)
Description:
Dirhamnolipid, specifically the compound with the name "2-o-α-l-rhamnopyranosyl-α-l-rhamnopyranosyl-β-hydroxydecanoyl-β-hydroxydecanoate" and CAS number 4348-76-9, is a type of biosurfactant produced by certain bacteria, notably Pseudomonas aeruginosa. This compound is characterized by its amphiphilic nature, which means it possesses both hydrophilic (water-attracting) and hydrophobic (water-repelling) properties, allowing it to reduce surface tension and stabilize emulsions. Dirhamnolipids are typically composed of rhamnose sugar units linked to fatty acid chains, contributing to their surfactant properties. They exhibit a range of biological activities, including antimicrobial effects, making them of interest in various applications such as bioremediation, agriculture, and pharmaceuticals. Additionally, dirhamnolipids are biodegradable and environmentally friendly, aligning with the growing demand for sustainable chemical alternatives. Their unique structure and properties make them valuable in enhancing the solubility and bioavailability of hydrophobic compounds in various formulations.
Formula:C32H58O13
InChI:InChI=1S/C32H58O13/c1-5-7-9-11-13-15-21(17-23(33)34)43-24(35)18-22(16-14-12-10-8-6-2)44-32-30(28(39)26(37)20(4)42-32)45-31-29(40)27(38)25(36)19(3)41-31/h19-22,25-32,36-40H,5-18H2,1-4H3,(H,33,34)/t19-,20-,21?,22?,25-,26-,27+,28+,29+,30+,31-,32-/m0/s1
InChI key:InChIKey=FCBUKWWQSZQDDI-SESCQDRSSA-N
SMILES:O([C@H]1[C@H](OC(CC(OC(CCCCCCC)CC(O)=O)=O)CCCCCCC)O[C@@H](C)[C@H](O)[C@H]1O)[C@H]2[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O2
Synonyms:- Decanoic acid, 3-[(6-deoxy-2-O-α-L-rhamnopyranosyl-α-L-mannopyranosyl)oxy]-, ester with 3-hydroxydecanoic acid
- BAC 3
- Decanoic acid, 3-((6-deoxy-2-O-(6-deoxy-alpha-L-mannopyranosyl)-alpha-L-mannopyranosyl)oxy)-, 1-(carboxymethyl)octyl ester
- 1-(Carboxymethyl)octyl 3-((6-deoxy-2-O-(6-deoxy-alpha-L-mannopyranosyl)-alpha-L-mannopyranosyl)oxy)decanoate
- Decanoic acid, 3-[[6-deoxy-2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-mannopyranosyl]oxy]-, 1-(carboxymethyl)octyl ester
- 2-O-α-L-Rhamnopyranosyl-α-L-rhamnopyranosyl-β-hydroxydecanoyl-β-hydroxydecanoic acid
- Decanoic acid, 3-[[6-deoxy-2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-mannopyranosyl]oxy]-, ester with 3-hydroxydecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Rhamnolipids C14
CAS:Rhamnose based 'green' surfactantFormula:C32H58O13Purity:Min. 95%Color and Shape:PowderMolecular weight:650.8 g/molRhamnolipids C8-C8
CAS:Rhamnolipids C8-C8 are a group of lipids that are produced by the bacterium Burkholderia cepacia. They have been shown to have a strong ability to bind to and remove substances from water, such as heavy metals, lignin, and polychlorinated biphenyls. Rhamnolipids C8-C8 can be used in industrial settings for wastewater treatment or in the environment for bioremediation of pollutants. The physicochemical properties of rhamnolipids C8-C8 are determined by their composition of fatty acids and their degree of unsaturation. These properties can vary depending on the origin of the bacteria producing them.
Formula:C22H40O9Purity:Min. 95%Molecular weight:448.55 g/molRhamnolipids C12
CAS:Rhamnose based 'green' surfactantFormula:C18H34O7Purity:Min. 95%Molecular weight:362.46 g/molRhamnolipids C10
CAS:Rhamnose based 'green' surfactantFormula:C32H58O13Purity:Min. 95%Color and Shape:PowderMolecular weight:650.8 g/molRhamnolipids C12-C12
CAS:rhamose based 'green' surfactant
Formula:C30H56O9Purity:Min. 95%Molecular weight:560.77 g/molRhamnolipids C10-C10
CAS:sugar based 'green' surfactantFormula:C26H48O9Purity:Min. 95%Molecular weight:504.66 g/mol
