CAS 434936-85-3
:imidazo[1,2-a]pyrazin-8-ol
Description:
Imidazo[1,2-a]pyrazin-8-ol is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state structure and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the hydroxyl group at the 8-position enhances its solubility in polar solvents and can influence its reactivity and interaction with biological targets. Imidazo[1,2-a]pyrazin-8-ol may participate in hydrogen bonding due to the hydroxyl group, which can affect its pharmacokinetic properties. Additionally, the compound's structure allows for various substitution patterns, which can lead to derivatives with altered biological activities. Its applications may include roles in drug development, particularly in the fields of oncology and neurology, where such heterocycles are often explored for their therapeutic potential. Overall, imidazo[1,2-a]pyrazin-8-ol represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C6H5N3O
InChI:InChI=1/C6H5N3O/c10-6-5-7-1-3-9(5)4-2-8-6/h1-4H,(H,8,10)
SMILES:c1cn2cc[nH]c(=O)c2n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Imidazo[1,2-a]pyrazin-8(7H)-one (9CI)
CAS:Formula:C6H5N3OPurity:95%Color and Shape:SolidMolecular weight:135.1234Imidazo[1,2-a]pyrazin-8(7H)-one
CAS:Formula:C6H5N3OPurity:95%Color and Shape:LiquidMolecular weight:135.126Imidazo[1,2-a]pyrazin-8-ol
CAS:Imidazo[1,2-a]pyrazin-8-ol is a quinoline derivative that was synthesized as an inhibitor of Mycobacterium smegmatis. This compound has shown activity against tuberculosis strains and other mycobacteria. Imidazo[1,2-a]pyrazin-8-ol inhibits the biosynthesis of mycolic acids, which are essential for the growth and survival of mycobacteria. Imidazo[1,2-a]pyrazin-8-ol is also effective in inhibiting the growth of methicillin resistant Staphylococcus aureus (MRSA) and other antibiotic resistant bacteria. The diversity of this molecule gives it great potential for use in drug discovery programs for tuberculosis and other infectious diseases.
Formula:C6H5N3OPurity:Min. 95%Molecular weight:135.12 g/mol


