CAS 4352-47-0

N-benzyl-1-cyclohexylmethanamine

Description:

N-benzyl-1-cyclohexylmethanamine, with the CAS number 4352-47-0, is an organic compound characterized by its amine functional group and a unique structure that includes a benzyl group and a cyclohexyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of both aromatic and aliphatic components in its structure can influence its solubility, reactivity, and interaction with biological systems. N-benzyl-1-cyclohexylmethanamine may exhibit basic properties due to the amine group, allowing it to participate in acid-base reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound represents a versatile building block in synthetic organic chemistry.

Formula: C₁₄H₂₁N

InChI: InChI=1/C14H21N/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h1,3-4,7-8,14-15H,2,5-6,9-12H2

SMILES: c1ccc(cc1)CNCC1CCCCC1

Synonyms:

• benzenemethanamine, N-(cyclohexylmethyl)-