CymitQuimica logo

CAS 4352-63-0

:

naphtho[2,1-b]furan-2(1H)-one

Description:
Naphtho[2,1-b]furan-2(1H)-one, with the CAS number 4352-63-0, is an organic compound characterized by its fused naphthalene and furan rings, which contribute to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is known for its aromatic nature, which can influence its reactivity and interactions with other substances. It features a carbonyl group (C=O) at the 2-position of the furan ring, making it a type of lactone. The presence of these structural elements often imparts biological activity, and compounds of this class may exhibit various pharmacological properties. Naphtho[2,1-b]furan-2(1H)-one can be synthesized through specific organic reactions, and its derivatives may be of interest in medicinal chemistry and materials science. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its applications in research and industry. Overall, this compound represents a fascinating area of study within organic chemistry due to its structural complexity and potential utility.
Formula:C12H8O2
InChI:InChI=1/C12H8O2/c13-12-7-10-9-4-2-1-3-8(9)5-6-11(10)14-12/h1-6H,7H2
SMILES:c1ccc2c(c1)ccc1c2CC(=O)O1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.