CymitQuimica logo

CAS 435283-95-7

:

4-[2-(3-bromophenoxy)ethyl]morpholine

Description:
4-[2-(3-Bromophenoxy)ethyl]morpholine is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound features a bromophenoxy group, where a bromine atom is substituted on a phenyl ring that is connected via an ether linkage to an ethyl group. The presence of the bromine atom introduces notable properties, such as increased lipophilicity and potential biological activity. Morpholine derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound's structure suggests it may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, its solubility and stability in various solvents can influence its reactivity and potential applications. Safety and handling considerations are essential, as brominated compounds can pose environmental and health risks. Overall, 4-[2-(3-bromophenoxy)ethyl]morpholine represents a unique chemical entity with potential utility in various scientific fields.
Formula:C12H16BrNO2
InChI:InChI=1/C12H16BrNO2/c13-11-2-1-3-12(10-11)16-9-6-14-4-7-15-8-5-14/h1-3,10H,4-9H2
InChI key:YZKFMBAOEVINLP-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)OCCN1CCOCC1)Br
Found 3 products.