CymitQuimica logo

CAS 435327-17-6

:

[1,1'-Binaphthalene]-2,2'-diol, 3,3'-bis(3,5-dimethylphenyl)-, (1S)-

Description:
[1,1'-Binaphthalene]-2,2'-diol, 3,3'-bis(3,5-dimethylphenyl)-, (1S)-, with CAS number 435327-17-6, is an organic compound characterized by its complex structure, which includes two naphthalene rings and multiple functional groups. This compound features two hydroxyl (-OH) groups located on the naphthalene moieties, contributing to its potential as a chiral ligand in asymmetric synthesis. The presence of the 3,5-dimethylphenyl substituents enhances its steric and electronic properties, making it useful in various chemical applications, including catalysis and material science. The (1S)- configuration indicates its specific stereochemistry, which is crucial for its reactivity and interaction with other molecules. Additionally, this compound may exhibit interesting optical properties due to its chiral nature, making it a subject of interest in studies related to chirality and enantioselectivity. Overall, [1,1'-Binaphthalene]-2,2'-diol, 3,3'-bis(3,5-dimethylphenyl)-, (1S)- is a significant compound in the field of organic chemistry, particularly in the development of chiral catalysts and materials.
Formula:C36H30O2
InChI:InChI=1S/C36H30O2/c1-21-13-22(2)16-27(15-21)31-19-25-9-5-7-11-29(25)33(35(31)37)34-30-12-8-6-10-26(30)20-32(36(34)38)28-17-23(3)14-24(4)18-28/h5-20,37-38H,1-4H3
InChI key:FODYBPPVIXVLOU-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=CC(=CC(=C6)C)C)O)C
Found 5 products.