CAS 435342-02-2

1H-Naphth[2,3-d]imidazole-2-methanamine, hydrochloride (1:2)

Description:

1H-Naphth[2,3-d]imidazole-2-methanamine, hydrochloride (1:2) is a chemical compound characterized by its imidazole and naphthalene structural components, which contribute to its unique properties. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form enhances its stability and solubility, which is beneficial for pharmaceutical formulations. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the imidazole moiety that can interact with biological targets. The compound's molecular structure allows for various functional modifications, which can lead to derivatives with enhanced efficacy or selectivity. As with many chemical substances, proper handling and safety measures should be observed, as it may exhibit toxicity or irritant properties. Overall, 1H-Naphth[2,3-d]imidazole-2-methanamine, hydrochloride is of interest in medicinal chemistry and drug development.

Formula: C₁₂H₁₁N₃·2ClH

InChI: InChI=1S/C12H11N3.2ClH/c13-7-12-14-10-5-8-3-1-2-4-9(8)6-11(10)15-12;;/h1-6H,7,13H2,(H,14,15);2*1H

InChI key: InChIKey=KXPFSPXDZIMEIZ-UHFFFAOYSA-N

SMILES: C(N)C=1NC=2C(=CC=3C(C2)=CC=CC3)N1.Cl

Synonyms:

• 1H-Naphth[2,3-d]imidazole-2-methanamine, dihydrochloride
• (1H-Naphtho[2,3-d]imidazol-2-yl)methanamine dihydrochloride
• 1H-Naphth[2,3-d]imidazole-2-methanamine, hydrochloride (1:2)

1-{1H-Naphtho[2,3-d]imidazol-2-yl}methanamine dihydrochloride

CAS: 435342-02-2

Versatile small molecule scaffold

Formula: C₁₂H₁₁N₃

Purity: Min. 95%

Molecular weight: 197.24 g/mol

Ref: 3D-KSA34202