CAS 435342-03-3: 3-Furancarboxylic acid, 5-(1,1-dimethylethyl)-2-(1-piperidinylmethyl)-, hydrochloride (1:1)

Description:3-Furancarboxylic acid, 5-(1,1-dimethylethyl)-2-(1-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a furan ring, a carboxylic acid functional group, and a piperidine moiety. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its hydrophobic characteristics, while the piperidine ring introduces basic properties, allowing for potential interactions with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for interactions with receptors or enzymes, which could be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.

Formula:C₁₅H₂₃NO₃·ClH

InChI:InChI=1S/C15H23NO3.ClH/c1-15(2,3)13-9-11(14(17)18)12(19-13)10-16-7-5-4-6-8-16;/h9H,4-8,10H2,1-3H3,(H,17,18);1H

InChI key:InChIKey=HJRRHYKSRYIONO-UHFFFAOYSA-N

SMILES:Cl.O=C(O)C=1C=C(OC1CN2CCCCC2)C(C)(C)C

Synonyms:
3-Furancarboxylic acid, 5-(1,1-dimethylethyl)-2-(1-piperidinylmethyl)-
3-Furancarboxylic acid, 5-(1,1-dimethylethyl)-2-(1-piperidinylmethyl)-, hydrochloride
3-Furancarboxylic acid, 5-(1,1-dimethylethyl)-2-(1-piperidinylmethyl)-, hydrochloride (1:1)
5-tert-Butyl-2-(piperidin-1-ylmethyl)-3-furoic acid