CAS 435345-42-9
:Piperazine, 1-(4-methylcyclohexyl)-, hydrochloride (1:1)
Description:
Piperazine, 1-(4-methylcyclohexyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This specific derivative features a 4-methylcyclohexyl group attached to one of the nitrogen atoms, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing neurotransmitter systems, which is common among piperazine derivatives. Its molecular structure suggests it could interact with various receptors, making it of interest in medicinal chemistry. Additionally, the presence of the methylcyclohexyl group may affect its lipophilicity and pharmacokinetic profile. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific modification of piperazine that may have implications in drug development and therapeutic applications.
Formula:C11H22N2·ClH
InChI:InChI=1S/C11H22N2.ClH/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13;/h10-12H,2-9H2,1H3;1H
InChI key:InChIKey=VCTBGKMKUPTDDI-UHFFFAOYSA-N
SMILES:CC1CCC(CC1)N2CCNCC2.Cl
Synonyms:- Piperazine, 1-(4-methylcyclohexyl)-, hydrochloride (1:1)
- Piperazine, 1-(4-methylcyclohexyl)-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
