CAS 4356-47-2

Calycotomine

Description:

Calycotomine, with the CAS number 4356-47-2, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. This substance is derived from certain plant species and is known for its potential pharmacological properties. Calycotomine exhibits a complex molecular structure, which contributes to its biological activity. It has been studied for various effects, including its potential antioxidant and anti-inflammatory properties. The compound's solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many alkaloids, it may interact with biological systems, influencing neurotransmitter activity or exhibiting effects on cellular processes. However, detailed studies on its specific mechanisms of action and therapeutic applications are still ongoing, and further research is necessary to fully understand its potential benefits and risks in medicinal chemistry.

Formula: C₁₂H₁₈NO₃

InChI: InChI=1/C12H17NO3/c1-15-11-5-8-3-4-13-10(7-14)9(8)6-12(11)16-2/h5-6,10,13-14H,3-4,7H2,1-2H3/p+1/t10-/m1/s1

Synonyms:

• 1,2,3,4-Tetrahydro-6,7-dimethoxy-1-isoquinolinemethanol
• (6,7-Dimethoxy-1,2,3,4-Tetrahydroisoquinolin-1-Yl)Methanol
• (1R)-1-(hydroxymethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolinium
• (1S)-1-(hydroxymethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolinium

(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol

CAS: 4356-47-2

(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol

Purity: ≥95%

Molecular weight: 223.27g/mol

Ref: 54-OR307630