CymitQuimica logo

CAS 4356-71-2

:

S,S'-octane-1,8-diyl dimethanesulfonothioate

Description:
S,S'-octane-1,8-diyl dimethanesulfonothioate is an organosulfur compound characterized by its unique structure, which includes a long carbon chain and sulfonothioate functional groups. This compound features two methanesulfonothioate groups attached to a straight-chain octane backbone, specifically at the 1 and 8 positions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of sulfur in its structure imparts distinct chemical properties, including potential reactivity with nucleophiles and electrophiles. This compound may exhibit moderate to low solubility in water but is generally soluble in organic solvents, making it useful in various applications, including as a chemical intermediate or in agrochemical formulations. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling, as organosulfur compounds can have specific toxicity profiles. Overall, S,S'-octane-1,8-diyl dimethanesulfonothioate is notable for its structural characteristics and potential applications in chemical synthesis.
Formula:C10H22O4S4
InChI:InChI=1/C10H22O4S4/c1-17(11,12)15-9-7-5-3-4-6-8-10-16-18(2,13)14/h3-10H2,1-2H3
SMILES:CS(=O)(=O)SCCCCCCCCSS(=O)(=O)C
Synonyms:
  • S-(8-([Methyl(dioxido)sulfanyl]sulfanyl)octyl) methanesulfonothioate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.