CAS 4356-83-6
:β-D-Glucopyranosiduronic acid, methyl 2,3,4-tris-O-(phenylmethyl)-, phenylmethyl ester
Description:
β-D-Glucopyranosiduronic acid, methyl 2,3,4-tris-O-(phenylmethyl)-, phenylmethyl ester, identified by CAS number 4356-83-6, is a complex organic compound characterized by its glucuronic acid structure modified with multiple phenylmethyl (benzyl) groups. This compound features a glucopyranose ring, which is a six-membered cyclic form of glucose, and is further functionalized with a uronic acid moiety, contributing to its solubility and reactivity. The presence of the phenylmethyl esters enhances its hydrophobic properties, making it useful in various chemical applications, including as a potential intermediate in organic synthesis or in the development of pharmaceuticals. The compound's structure suggests it may exhibit interesting biological activities, although specific biological properties would require further investigation. Its synthesis typically involves glycosylation reactions and esterification processes, which are common in carbohydrate chemistry. Overall, this compound exemplifies the complexity and versatility of carbohydrate derivatives in organic chemistry.
Formula:C35H36O7
InChI:InChI=1S/C35H36O7/c1-37-35-33(40-24-28-18-10-4-11-19-28)31(39-23-27-16-8-3-9-17-27)30(38-22-26-14-6-2-7-15-26)32(42-35)34(36)41-25-29-20-12-5-13-21-29/h2-21,30-33,35H,22-25H2,1H3/t30-,31-,32-,33+,35+/m0/s1
InChI key:InChIKey=ZSBAMJXOTVTRDC-MNYCWKMRSA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@H](OCC3=CC=CC=C3)[C@@H](C(OCC4=CC=CC=C4)=O)O[C@@H](OC)[C@@H]2OCC5=CC=CC=C5
Synonyms:- β-D-Glucopyranosiduronic acid, methyl 2,3,4-tris-O-(phenylmethyl)-, phenylmethyl ester
- Glucopyranosiduronic acid, methyl 2,3,4-tri-O-benzyl-, benzyl ester, β-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3,4-Tri-O-benzyl-β-D-glucuronic Acid, Benzyl Ester
CAS:Controlled ProductApplications Methyl 2,3,4-Tri-O-benzyl-β-D-glucuronic Acid, Benzyl Ester (cas# 4356-83-6) is a compound useful in organic synthesis.
Formula:C35H36O7Color and Shape:NeatMolecular weight:568.66Methyl 2,3,4-tri-O-benzyl-b-D-glucuronide benzyl ester
CAS:Methyl 2,3,4-tri-O-benzyl-b-D-glucuronide benzyl ester is a custom synthesis that can be used as a glycosylation or methylation reagent. It has been shown to be an effective click modification reagent and can be used in the synthesis of complex carbohydrates. This compound is a carbohydrate that has been modified with fluorination and methylation. This compound has saccharide units and is a sugar. It is soluble in water and ethanol.Formula:C35H36O7Purity:Min. 95%Molecular weight:568.66 g/mol

