CAS 4356-84-7
:Methyl β-D-glucuronide
Description:
Methyl β-D-glucuronide is a glycoside derived from glucuronic acid, characterized by the presence of a methyl group attached to the anomeric carbon of the glucuronic acid moiety. It is a colorless to pale yellow solid that is soluble in water and polar organic solvents, reflecting its hydrophilic nature due to the presence of multiple hydroxyl groups. This compound is often used in biochemical research and pharmaceutical applications, particularly in studies involving drug metabolism and detoxification processes, as it serves as a conjugate that facilitates the excretion of various substances. Methyl β-D-glucuronide can participate in various chemical reactions, including hydrolysis and glycosylation, making it a versatile building block in organic synthesis. Its stability under physiological conditions allows it to be a useful model for studying glucuronidation, a key metabolic pathway in the liver. Overall, its unique structural features and solubility properties make it an important compound in both research and industrial applications.
Formula:C7H12O7
InChI:InChI=1S/C7H12O7/c1-13-7-4(10)2(8)3(9)5(14-7)6(11)12/h2-5,7-10H,1H3,(H,11,12)/t2-,3-,4+,5-,7+/m0/s1
InChI key:InChIKey=BOFXVYGDIRCHEQ-GHQVIJFQSA-N
SMILES:C(O)(=O)[C@H]1O[C@@H](OC)[C@H](O)[C@@H](O)[C@@H]1O
Synonyms:- Glucopyranosiduronic acid, methyl, β-D-
- β-D-Glucopyranosiduronic acid, methyl
- Methyl β-D-glucopyranosiduronic acid
- Methyl β-D-glucuronide
- Methyl β-glucuronide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl b-D-glucuronide
CAS:<p>Methyl b-D-glucuronide is a glucuronide compound, which is a derivative of D-glucuronic acid. It is typically sourced from the oxidation of glucose, which naturally occurs in plants and the human body. As a derivative, Methyl b-D-glucuronide is involved in the conjugation processes that aid in the detoxification and elimination of various compounds.The mode of action for Methyl b-D-glucuronide centers around its conversion by UDP-glucuronosyltransferases in the conjugation pathway, rendering xenobiotics and endogenous substances more water-soluble for excretion. This ability to facilitate glucuronidation makes it a valuable model compound in biochemical research and pharmacology, particularly in studying metabolism and pharmacokinetics of drugs.In terms of applications, Methyl b-D-glucuronide finds significant use in analytical chemistry and molecular biology. It serves as a reference or control compound in enzyme assays and studies investigating drug metabolism and transport. Additionally, its role in detoxification pathways offers insights into liver function and disease mechanisms, providing a foundation for developing therapeutic interventions. Such versatile uses make it an integral component in physiological and pharmacological research.</p>Purity:Min. 95%Color and Shape:Powder
