CAS 436086-91-8

3-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde

Description:

3-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde is an organic compound characterized by its complex structure, which includes a pyrazole ring and a methoxy-substituted benzaldehyde moiety. The presence of the pyrazole ring, which is a five-membered heterocyclic compound containing two nitrogen atoms, contributes to its potential biological activity and reactivity. The methoxy group (-OCH3) on the benzaldehyde enhances its solubility in organic solvents and may influence its electronic properties. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in medicinal chemistry, particularly due to the presence of the pyrazole, which is known for various biological activities. Additionally, the compound's aldehyde functional group (-CHO) can participate in further chemical reactions, such as condensation or reduction, making it versatile in synthetic pathways. Overall, this compound exemplifies the intersection of heterocyclic chemistry and aromatic chemistry, with implications for various fields of research.

Formula: C₁₄H₁₆N₂O₂

InChI: InChI=1S/C14H16N2O2/c1-10-6-11(2)16(15-10)8-13-7-12(9-17)4-5-14(13)18-3/h4-7,9H,8H2,1-3H3

InChI key: InChIKey=XEUFDSHRBLJIJK-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(C=O)=C1)N2C(C)=CC(C)=N2

Synonyms:

• 3-[(3,5-Dimethylpyrazol-1-yl)methyl]-4-methoxybenzaldehyde
• Benzaldehyde, 3-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxy-
• 3-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde