CymitQuimica logo

CAS 436086-99-6

:

1-pyridin-4-yl-N-(tetrahydrofuran-2-ylmethyl)methanamine

Description:
1-Pyridin-4-yl-N-(tetrahydrofuran-2-ylmethyl)methanamine, identified by its CAS number 436086-99-6, is a chemical compound characterized by its unique structure that includes a pyridine ring and a tetrahydrofuran moiety. This compound features a methanamine functional group, which contributes to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of the pyridine ring imparts basic properties, making it capable of participating in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The tetrahydrofuran group adds to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. Overall, 1-pyridin-4-yl-N-(tetrahydrofuran-2-ylmethyl)methanamine represents a versatile structure with potential applications in various fields of chemistry.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-2-11(14-7-1)9-13-8-10-3-5-12-6-4-10/h3-6,11,13H,1-2,7-9H2
SMILES:C1CC(CNCc2ccncc2)OC1
Synonyms:
  • 4-pyridinemethanamine, N-[(tetrahydro-2-furanyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.