CymitQuimica logo

CAS 436087-09-1

:

1-[2-(Hexahydro-1H-azepin-1-yl)-2-oxoethyl]-1H-indole-3-carboxaldehyde

Description:
1-[2-(Hexahydro-1H-azepin-1-yl)-2-oxoethyl]-1H-indole-3-carboxaldehyde, with the CAS number 436087-09-1, is a chemical compound characterized by its complex structure, which includes an indole moiety and a hexahydroazepine ring. This compound typically exhibits properties associated with both indole derivatives and cyclic amines, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the aldehyde functional group suggests it may engage in nucleophilic addition reactions, while the indole structure can contribute to aromatic stability and potential interactions with biological targets. Additionally, the hexahydroazepine component may influence the compound's solubility and reactivity. Overall, this compound may be of interest in medicinal chemistry and drug development due to its unique structural features, which could lead to diverse pharmacological properties. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C17H20N2O2
InChI:InChI=1S/C17H20N2O2/c20-13-14-11-19(16-8-4-3-7-15(14)16)12-17(21)18-9-5-1-2-6-10-18/h3-4,7-8,11,13H,1-2,5-6,9-10,12H2
InChI key:InChIKey=UMAXGKQIHUWZFH-UHFFFAOYSA-N
SMILES:C(C(=O)N1CCCCCC1)N2C=3C(C(C=O)=C2)=CC=CC3
Synonyms:
  • 1H-Azepine, 1-[(3-formyl-1H-indol-1-yl)acetyl]hexahydro-
  • 1-(2-Azepan-1-yl-2-oxo-ethyl)-1H-indole-3-carbaldehyde
  • 1H-Indole-3-carboxaldehyde, 1-[2-(hexahydro-1H-azepin-1-yl)-2-oxoethyl]-
  • 1-[2-(Hexahydro-1H-azepin-1-yl)-2-oxoethyl]-1H-indole-3-carboxaldehyde
  • 1H-Indole-3-carboxaldehyde, 1-[2-(hexahydro-1H-azepin-1-yl)-2-oxoethyl]-
  • 1-[2-(Azepan-1-yl)-2-oxoethyl]-1H-indole-3-carbaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.