CAS 436087-23-9

N-[4-(azepan-1-yl)phenyl]-2-chloroacetamide

Description:

N-[4-(azepan-1-yl)phenyl]-2-chloroacetamide is a chemical compound characterized by its unique structure, which includes an azepane ring and a chloroacetamide functional group. The azepane moiety contributes to its cyclic amine properties, potentially influencing its biological activity and solubility. The presence of the chloroacetamide group suggests that it may participate in nucleophilic substitution reactions, making it a candidate for various synthetic applications. This compound may exhibit specific pharmacological properties, as many compounds with similar structures are investigated for their potential therapeutic effects. Its molecular interactions, stability, and reactivity can be influenced by the presence of the chlorine atom and the azepane ring, which may affect its lipophilicity and ability to cross biological membranes. As with many organic compounds, the characteristics such as melting point, boiling point, and solubility in various solvents would be essential for practical applications and further research. Safety data and handling precautions should be considered, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₁₄H₁₉ClN₂O

InChI: InChI=1/C14H19ClN2O/c15-11-14(18)16-12-5-7-13(8-6-12)17-9-3-1-2-4-10-17/h5-8H,1-4,9-11H2,(H,16,18)

SMILES: C1CCCN(CC1)c1ccc(cc1)NC(=O)CCl

Synonyms:

• Acetamide, 2-chloro-N-[4-(hexahydro-1H-azepin-1-yl)phenyl]-
• N-(4-azepan-1-ylphenyl)-2-chloroacetamide
• N-[4-(Azepan-1-yl)phenyl]-2-chloroacetamide

N-[4-(Azepan-1-yl)phenyl]-2-chloroacetamide

CAS: 436087-23-9

Versatile small molecule scaffold

Formula: C₁₄H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 266.76 g/mol

Ref: 3D-LSA08723