CAS 436088-46-9

β-[(Cyclohexylcarbonyl)amino]benzenepropanoic acid

Description:

β-[(Cyclohexylcarbonyl)amino]benzenepropanoic acid, with the CAS number 436088-46-9, is a chemical compound characterized by its unique structure that includes a cyclohexylcarbonyl group attached to an amino group, which is further linked to a benzenepropanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It may display moderate solubility in organic solvents and limited solubility in water, which is common for compounds with large hydrophobic groups. The presence of the amino group suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the cyclohexyl group may impart steric hindrance, affecting the compound's conformation and reactivity. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals where modifications to the amino acid structure can lead to enhanced biological activity or specificity. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₂₁NO₃

InChI: InChI=1S/C16H21NO3/c18-15(19)11-14(12-7-3-1-4-8-12)17-16(20)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-11H2,(H,17,20)(H,18,19)

InChI key: InChIKey=UIHUXKARHPECCF-UHFFFAOYSA-N

SMILES: C(NC(=O)C1CCCCC1)(CC(O)=O)C2=CC=CC=C2

Synonyms:

• Benzenepropanoic acid, β-[(cyclohexylcarbonyl)amino]-
• β-[(Cyclohexylcarbonyl)amino]benzenepropanoic acid