CAS 436088-72-1
:N-[(2-Chlorophenyl)methyl]-2-furanmethanamine
Description:
N-[(2-Chlorophenyl)methyl]-2-furanmethanamine, identified by its CAS number 436088-72-1, is a chemical compound characterized by its unique structure, which includes a furan ring and a chlorophenyl group. This compound typically exhibits properties associated with both amines and aromatic compounds, such as potential basicity due to the amine functional group and hydrophobic characteristics from the aromatic ring. The presence of the chlorophenyl moiety may influence its reactivity and biological activity, potentially enhancing lipophilicity and affecting interactions with biological targets. Additionally, the furan ring contributes to the compound's stability and may participate in various chemical reactions, including electrophilic substitutions. The compound's specific applications and behavior in biological systems would depend on its interactions with receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. Overall, N-[(2-Chlorophenyl)methyl]-2-furanmethanamine represents a class of compounds that may have significant implications in drug development and chemical research.
Formula:C12H12ClNO
InChI:InChI=1S/C12H12ClNO/c13-12-6-2-1-4-10(12)8-14-9-11-5-3-7-15-11/h1-7,14H,8-9H2
InChI key:InChIKey=PAUGPUKAWMVYKS-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CO1)C2=C(Cl)C=CC=C2
Synonyms:- 2-Furanmethanamine, N-[(2-chlorophenyl)methyl]-
- N-[(2-Chlorophenyl)methyl]-2-furanmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.