CAS 436088-78-7

4-[[4,5-Dihydro-5,5-bis(hydroxymethyl)-4-oxo-2-thiazolyl]amino]benzoic acid

Description:

4-[[4,5-Dihydro-5,5-bis(hydroxymethyl)-4-oxo-2-thiazolyl]amino]benzoic acid, with CAS number 436088-78-7, is a chemical compound characterized by its complex structure, which includes a thiazole ring and an amino group attached to a benzoic acid moiety. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of hydroxymethyl groups that enhance its hydrophilicity. The thiazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly for its possible antimicrobial or anticancer properties. The presence of multiple functional groups, including carboxylic acid and amine, suggests that it may engage in various chemical reactions, such as esterification or amidation. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, this substance represents a unique class of organic compounds with potential applications in medicinal chemistry and biochemistry.

Formula: C₁₂H₁₂N₂O₅S

InChI: InChI=1S/C12H12N2O5S/c15-5-12(6-16)10(19)14-11(20-12)13-8-3-1-7(2-4-8)9(17)18/h1-4,15-16H,5-6H2,(H,17,18)(H,13,14,19)

InChI key: InChIKey=XHMVPBDCSHQQQC-UHFFFAOYSA-N

SMILES: C(O)C1(CO)SC(NC2=CC=C(C(O)=O)C=C2)=NC1=O

Synonyms:

• Benzoic acid, 4-[[4,5-dihydro-5,5-bis(hydroxymethyl)-4-oxo-2-thiazolyl]amino]-
• 4-[[4,5-Dihydro-5,5-bis(hydroxymethyl)-4-oxo-2-thiazolyl]amino]benzoic acid