CAS 436088-89-0

3-amino-4-[(pyridin-3-ylmethyl)amino]benzoic acid

Description:

3-amino-4-[(pyridin-3-ylmethyl)amino]benzoic acid, identified by its CAS number 436088-89-0, is an organic compound characterized by its complex structure, which includes an amino group and a benzoic acid moiety. This compound features a pyridine ring substituted with a methylamino group, contributing to its potential biological activity. The presence of both amino and carboxylic acid functional groups suggests that it can participate in various chemical reactions, including hydrogen bonding and acid-base interactions. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility and stability can vary depending on the pH of the environment, which is typical for amino acids and their derivatives. Additionally, its ability to form salts and complexes with metal ions may enhance its utility in various chemical and biological contexts. Overall, this compound represents a versatile building block for further chemical synthesis and research in drug development.

Formula: C₁₃H₁₃N₃O₂

InChI: InChI=1/C13H13N3O2/c14-11-6-10(13(17)18)3-4-12(11)16-8-9-2-1-5-15-7-9/h1-7,16H,8,14H2,(H,17,18)

SMILES: c1cc(cnc1)CNc1ccc(cc1N)C(=O)O

Synonyms:

• Benzoic Acid, 3-Amino-4-[(3-Pyridinylmethyl)Amino]-

3-Amino-4-[(pyridin-3-ylmethyl)-amino]-benzoic acid

CAS: 436088-89-0

Formula: C₁₃H₁₃N₃O₂

Purity: 95.0%

Molecular weight: 243.266

Ref: 10-F057014