CAS 436089-02-0

N-(5-amino-2-methylphenyl)propanamide

Description:

N-(5-amino-2-methylphenyl)propanamide, also known by its CAS number 436089-02-0, is an organic compound characterized by its amide functional group and an aromatic ring. This substance features a propanamide backbone, which is linked to a 5-amino-2-methylphenyl group, indicating the presence of an amino group (-NH2) and a methyl group (-CH3) on the aromatic ring. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active compounds. The presence of the amino group may also impart basic properties, influencing its reactivity and interaction with other chemical species. Overall, N-(5-amino-2-methylphenyl)propanamide is a compound of interest in medicinal chemistry and materials science, warranting further investigation into its properties and potential applications.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1/C10H14N2O/c1-3-10(13)12-9-6-8(11)5-4-7(9)2/h4-6H,3,11H2,1-2H3,(H,12,13)

SMILES: CCC(=Nc1cc(ccc1C)N)O

Synonyms:

• propanamide, N-(5-amino-2-methylphenyl)-
• N-(5-Amino-2-methylphenyl)propanamide

N-(5-amino-2-methylphenyl)propanamide

CAS: 436089-02-0

Formula: C₁₀H₁₄N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 178.235

Ref: 10-F310525