CAS 436090-51-6
:N-(5-Amino-2-methoxyphenyl)-4-morpholineacetamide
Description:
N-(5-Amino-2-methoxyphenyl)-4-morpholineacetamide, with the CAS number 436090-51-6, is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group, a methoxy group, and a morpholine ring, which contribute to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy group can influence the compound's electronic properties and steric hindrance, potentially affecting its interaction with biological targets. Morpholine, a cyclic amine, adds to the compound's stability and may enhance its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit activity against specific biological pathways or targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography.
Formula:C13H20N3O3
InChI:InChI=1/C13H19N3O3/c1-18-12-3-2-10(14)8-11(12)15-13(17)9-16-4-6-19-7-5-16/h2-3,8H,4-7,9,14H2,1H3,(H,15,17)/p+1
InChI key:InChIKey=MNFRBLGBBIMAOZ-UHFFFAOYSA-N
SMILES:N(C(CN1CCOCC1)=O)C2=C(OC)C=CC(N)=C2
Synonyms:- 4-Morpholineacetamide, N-(5-amino-2-methoxyphenyl)-
- N-(5-Amino-2-methoxyphenyl)-4-morpholineacetamide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.