CAS 436091-59-7

1H-indole, 4-bromo-7-methoxy-

Description:

1H-Indole, 4-bromo-7-methoxy- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 4-position and a methoxy group at the 7-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The bromine substituent can enhance the compound's reactivity, while the methoxy group may influence its electronic properties and steric hindrance. The compound's molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, its synthesis may involve standard organic reactions such as bromination and methoxylation. As with many indole derivatives, it may also exhibit fluorescence, making it useful in various applications, including as a fluorescent probe in biochemical assays. Safety and handling precautions should be observed due to the potential hazards associated with brominated compounds.

Formula: C₉H₈BrNO

InChI: InChI=1/C9H8BrNO/c1-12-8-3-2-7(10)6-4-5-11-9(6)8/h2-5,11H,1H3

SMILES: COc1ccc(c2cc[nH]c12)Br

Synonyms:

• 4-bromo-7-methoxy-1H-indole

4-Bromo-7-methoxy-1H-indole

CAS: 436091-59-7

Formula: C₉H₈BrNO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 226.0699

Ref: IN-DA00DG6G

4-Bromo-7-methoxy-1H-indole

CAS: 436091-59-7

4-Bromo-7-methoxy-1H-indole

Purity: 98%

Molecular weight: 226.07g/mol

Ref: 54-OR76331

4-Bromo-7-methoxy-1H-indole

CAS: 436091-59-7

Formula: C₉H₈BrNO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 226.073

Ref: 10-F216991