CAS 436091-81-5

[5-(4-fluorophenyl)-2H-tetrazol-2-yl]acetic acid

Description:

[5-(4-fluorophenyl)-2H-tetrazol-2-yl]acetic acid is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of a 4-fluorophenyl group indicates that there is a fluorine substituent on a phenyl ring, contributing to the compound's potential biological activity and lipophilicity. The acetic acid functional group suggests that the compound is acidic, which may influence its solubility and reactivity in various environments. This compound may exhibit interesting pharmacological properties due to the combination of the tetrazole and aromatic systems, making it a subject of interest in medicinal chemistry. Its CAS number, 436091-81-5, allows for easy identification in chemical databases. Overall, the unique structural features of [5-(4-fluorophenyl)-2H-tetrazol-2-yl]acetic acid may lead to diverse applications in drug development and other chemical research fields.

Formula: C₉H₇FN₄O₂

InChI: InChI=1/C9H7FN4O2/c10-7-3-1-6(2-4-7)9-11-13-14(12-9)5-8(15)16/h1-4H,5H2,(H,15,16)

SMILES: c1cc(ccc1c1nnn(CC(=O)O)n1)F

Synonyms:

• 2H-tetrazole-2-acetic acid, 5-(4-fluorophenyl)-

[5-(4-Fluoro-phenyl)-tetrazol-2-yl]-acetic acid

CAS: 436091-81-5

Formula: C₉H₇FN₄O₂

Purity: 95.0%

Molecular weight: 222.179

Ref: 10-F057667