CAS 436091-88-2

4-Amino-N-cyclopentylbenzenesulfonamide

Description:

4-Amino-N-cyclopentylbenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features an amino group (-NH2) and a cyclopentyl group attached to a benzene ring, contributing to its unique structural and chemical properties. The presence of the sulfonamide moiety enhances its potential as a pharmacological agent, particularly in medicinal chemistry. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and sulfonamide groups. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by the substituents on the benzene ring and the cyclopentyl group, which may affect its biological activity and pharmacokinetics. Overall, 4-Amino-N-cyclopentylbenzenesulfonamide represents a class of compounds that could be explored for therapeutic applications, particularly in the treatment of bacterial infections.

Formula: C₁₁H₁₆N₂O₂S

InChI: InChI=1S/C11H16N2O2S/c12-9-5-7-11(8-6-9)16(14,15)13-10-3-1-2-4-10/h5-8,10,13H,1-4,12H2

InChI key: InChIKey=XNPAQSUBTOJSLM-UHFFFAOYSA-N

SMILES: S(NC1CCCC1)(=O)(=O)C2=CC=C(N)C=C2

Synonyms:

• 4-Amino-N-cyclopentylbenzenesulfonamide
• Benzenesulfonamide, 4-amino-N-cyclopentyl-

4-Amino-N-cyclopentylbenzene-1-sulfonamide

CAS: 436091-88-2

4-Amino-N-cyclopentylbenzene-1-sulfonamide (ZL0420) is a potential drug that is being researched for the treatment of inflammation. It inhibits the enzyme bromodomain, which is involved in immune function and cancer cell growth. The molecule has been shown to bind to the bromodomains on human cells, leading to a decrease in cytokine production and inflammatory response. ZL0420 also has low toxicity and high affinity for its target. This drug can be used as an inhibitor for other drugs that are designed for the treatment of inflammation or cancer, such as ZL0454.

Formula: C₁₁H₁₆N₂O₂S

Purity: Min. 95%

Molecular weight: 240.32 g/mol

Ref: 3D-LSA09188