CAS 436092-91-0
:2-[5-(4-aminophenyl)-2H-tetrazol-2-yl]-N,N-diethylacetamide
Description:
2-[5-(4-Aminophenyl)-2H-tetrazol-2-yl]-N,N-diethylacetamide, with the CAS number 436092-91-0, is a chemical compound characterized by its complex structure, which includes a tetrazole ring and an acetamide moiety. The presence of the tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their diverse pharmacological properties. The compound features an amine group, which may enhance its solubility and reactivity. Its diethylacetamide structure suggests that it may exhibit lipophilic characteristics, potentially influencing its absorption and distribution in biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with biological targets. Additionally, the presence of the aromatic amine may provide opportunities for further functionalization or modification, enhancing its utility in various chemical applications. Overall, the compound's characteristics suggest potential for research in drug development and related fields.
Formula:C13H18N6O
InChI:InChI=1/C13H18N6O/c1-3-18(4-2)12(20)9-19-16-13(15-17-19)10-5-7-11(14)8-6-10/h5-8H,3-4,9,14H2,1-2H3
Synonyms:- 2H-Tetrazole-2-acetamide, 5-(4-aminophenyl)-N,N-diethyl-
- 2-[5-(4-Aminophenyl)-2H-tetrazol-2-yl]-N,N-diethylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[5-(4-Amino-phenyl)-tetrazol-2-yl]-N,N-diethyl-acetamide
CAS:Formula:C13H18N6OMolecular weight:274.3216
