CAS 436095-78-2

N-[4-(5-thioxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide

Description:

N-[4-(5-thioxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide is a chemical compound characterized by its unique structure, which includes a phenyl group substituted with a methanesulfonamide moiety and a thioxo-dihydro-oxadiazole ring. This compound typically exhibits properties such as solubility in polar solvents, which is common for sulfonamide derivatives, and may display biological activity due to the presence of the oxadiazole ring, known for its potential pharmacological properties. The thioxo group can contribute to its reactivity and interaction with biological targets. As a sulfonamide, it may also possess antibacterial or antifungal properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting specific enzymes or receptors. However, detailed studies would be necessary to fully elucidate its biological activity, toxicity, and therapeutic potential.

Formula: C₉H₉N₃O₃S₂

InChI: InChI=1/C9H9N3O3S2/c1-17(13,14)12-7-4-2-6(3-5-7)8-10-11-9(16)15-8/h2-5,12H,1H3,(H,11,16)

SMILES: CS(=O)(=O)Nc1ccc(cc1)c1nnc(o1)S

Synonyms:

• Methanesulfonamide, N-[4-(5-mercapto-1,3,4-oxadiazol-2-yl)phenyl]-
• N-[4-(5-Sulfanyl-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide

N-[4-(5-Mercapto-[1,3,4]oxadiazol-2-yl)-phenyl]-methanesulfonamide

CAS: 436095-78-2

Formula: C₉H₉N₃O₃S₂

Color and Shape: Solid

Molecular weight: 271.31

Ref: 10-F026247